C21H17Br2N2O4S- — CID 46371368
4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]-N-oxidobenzamide (PubChem CID 46371368) has the molecular formula C21H17Br2N2O4S- and a molecular weight of 553.25 g/mol. Its IUPAC name is 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]-N-oxidobenzamide.
| Compound Name | 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]-N-oxidobenzamide |
|---|---|
| PubChem CID | 46371368 |
| Molecular Formula | C21H17Br2N2O4S- |
| Molecular Weight | 553.25 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]-N-oxidobenzamide |
| SMILES | O=C(N[O-])c1ccc(CN(Cc2ccc(Br)cc2)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C21H17Br2N2O4S/c22-18-7-3-16(4-8-18)14-25(30(28,29)20-11-9-19(23)10-12-20)13-15-1-5-17(6-2-15)21(26)24-27/h1-12H,13-14H2,(H-,24,26,27)/q-1 |
| InChIKey | KVUIHZDOWXYQDF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|