C22H19BrFN2O4S- — CID 20967392
4-[[(3-bromophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]methyl]-N-oxidobenzamide (PubChem CID 20967392) has the molecular formula C22H19BrFN2O4S- and a molecular weight of 506.37 g/mol. Its IUPAC name is 4-[[(3-bromophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]methyl]-N-oxidobenzamide.
| Compound Name | 4-[[(3-bromophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]methyl]-N-oxidobenzamide |
|---|---|
| PubChem CID | 20967392 |
| Molecular Formula | C22H19BrFN2O4S- |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 505.02 |
| IUPAC Name | 4-[[(3-bromophenyl)methyl-(4-fluoro-3-methylphenyl)sulfonylamino]methyl]-N-oxidobenzamide |
| SMILES | Cc1cc(S(=O)(=O)N(Cc2ccc(C(=O)N[O-])cc2)Cc2cccc(Br)c2)ccc1F |
| InChI | InChI=1S/C22H19BrFN2O4S/c1-15-11-20(9-10-21(15)24)31(29,30)26(14-17-3-2-4-19(23)12-17)13-16-5-7-18(8-6-16)22(27)25-28/h2-12H,13-14H2,1H3,(H-,25,27,28)/q-1 |
| InChIKey | MZXZJBCUARIHNF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|