C23H21Br2NO4S — CID 4053596
ethyl 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]benzoate (PubChem CID 4053596) has the molecular formula C23H21Br2NO4S and a molecular weight of 567.30 g/mol. Its IUPAC name is ethyl 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 4053596 |
| Molecular Formula | C23H21Br2NO4S |
| Molecular Weight | 567.30 g/mol |
| Exact Mass | 564.96 |
| IUPAC Name | ethyl 4-[[(4-bromophenyl)methyl-(4-bromophenyl)sulfonylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN(Cc2ccc(Br)cc2)S(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H21Br2NO4S/c1-2-30-23(27)19-7-3-17(4-8-19)15-26(16-18-5-9-20(24)10-6-18)31(28,29)22-13-11-21(25)12-14-22/h3-14H,2,15-16H2,1H3 |
| InChIKey | QTNPIEBWXZEJML-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |