C26H35N2NaO5S — CID 146061418
sodium 4-[[(4-tert-butylphenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-oxidocyclohexane-1-carboxamide (PubChem CID 146061418) has the molecular formula C26H35N2NaO5S and a molecular weight of 510.63 g/mol. Its IUPAC name is sodium 4-[[(4-tert-butylphenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-oxidocyclohexane-1-carboxamide.
| Compound Name | sodium 4-[[(4-tert-butylphenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-oxidocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 146061418 |
| Molecular Formula | C26H35N2NaO5S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | sodium 4-[[(4-tert-butylphenyl)sulfonyl-[(4-methoxyphenyl)methyl]amino]methyl]-N-oxidocyclohexane-1-carboxamide |
| SMILES | COc1ccc(CN(CC2CCC(C(=O)N[O-])CC2)S(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1.[Na+] |
| InChI | InChI=1S/C26H35N2O5S.Na/c1-26(2,3)22-11-15-24(16-12-22)34(31,32)28(18-20-7-13-23(33-4)14-8-20)17-19-5-9-21(10-6-19)25(29)27-30;/h7-8,11-16,19,21H,5-6,9-10,17-18H2,1-4H3,(H-,27,29,30);/q-1;+1 |
| InChIKey | BPIHZCDCOQYBOV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|