C23H26ClN2NaO6S — CID 146061416
sodium 4-[[(4-chlorophenyl)methyl-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]methyl]-N-oxidocyclohexane-1-carboxamide (PubChem CID 146061416) has the molecular formula C23H26ClN2NaO6S and a molecular weight of 516.98 g/mol. Its IUPAC name is sodium 4-[[(4-chlorophenyl)methyl-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]methyl]-N-oxidocyclohexane-1-carboxamide.
| Compound Name | sodium 4-[[(4-chlorophenyl)methyl-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]methyl]-N-oxidocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 146061416 |
| Molecular Formula | C23H26ClN2NaO6S |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | sodium 4-[[(4-chlorophenyl)methyl-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)amino]methyl]-N-oxidocyclohexane-1-carboxamide |
| SMILES | O=C(N[O-])C1CCC(CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)CC1.[Na+] |
| InChI | InChI=1S/C23H26ClN2O6S.Na/c24-19-7-3-17(4-8-19)15-26(14-16-1-5-18(6-2-16)23(27)25-28)33(29,30)20-9-10-21-22(13-20)32-12-11-31-21;/h3-4,7-10,13,16,18H,1-2,5-6,11-12,14-15H2,(H-,25,27,28);/q-1;+1 |
| InChIKey | MCLQXPOKFQKLKP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|