C25H33N2NaO4S — CID 146071514
sodium 4-[[(2-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]-N-oxidocyclohexane-1-carboxamide (PubChem CID 146071514) has the molecular formula C25H33N2NaO4S and a molecular weight of 480.61 g/mol. Its IUPAC name is sodium 4-[[(2-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]-N-oxidocyclohexane-1-carboxamide.
| Compound Name | sodium 4-[[(2-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]-N-oxidocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 146071514 |
| Molecular Formula | C25H33N2NaO4S |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | sodium 4-[[(2-methylphenyl)methyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]-N-oxidocyclohexane-1-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(Cc2ccccc2C)CC2CCC(C(=O)N[O-])CC2)c(C)c1.[Na+] |
| InChI | InChI=1S/C25H33N2O4S.Na/c1-17-13-19(3)24(20(4)14-17)32(30,31)27(16-23-8-6-5-7-18(23)2)15-21-9-11-22(12-10-21)25(28)26-29;/h5-8,13-14,21-22H,9-12,15-16H2,1-4H3,(H-,26,28,29);/q-1;+1 |
| InChIKey | KBNYYFMIPNPPOY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|