C25H31N2O2S- — CID 4547693
4-[[(2,5-dimethylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 4547693) has the molecular formula C25H31N2O2S- and a molecular weight of 423.60 g/mol. Its IUPAC name is 4-[[(2,5-dimethylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | 4-[[(2,5-dimethylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4547693 |
| Molecular Formula | C25H31N2O2S- |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4-[[(2,5-dimethylphenyl)carbamothioyl-[(2-methylphenyl)methyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc(C)c(NC(=S)N(Cc2ccccc2C)CC2CCC(C(=O)[O-])CC2)c1 |
| InChI | InChI=1S/C25H32N2O2S/c1-17-8-9-19(3)23(14-17)26-25(30)27(16-22-7-5-4-6-18(22)2)15-20-10-12-21(13-11-20)24(28)29/h4-9,14,20-21H,10-13,15-16H2,1-3H3,(H,26,30)(H,28,29)/p-1 |
| InChIKey | BUEFFIROKBMSPC-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|