C22H26Cl2N2O4S — CID 92695209
4-[[(3-chloro-2-methylphenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]methyl]-N-hydroxycyclohexane-1-carboxamide (PubChem CID 92695209) has the molecular formula C22H26Cl2N2O4S and a molecular weight of 485.43 g/mol. Its IUPAC name is 4-[[(3-chloro-2-methylphenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]methyl]-N-hydroxycyclohexane-1-carboxamide.
| Compound Name | 4-[[(3-chloro-2-methylphenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]methyl]-N-hydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 92695209 |
| Molecular Formula | C22H26Cl2N2O4S |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 4-[[(3-chloro-2-methylphenyl)sulfonyl-[(4-chlorophenyl)methyl]amino]methyl]-N-hydroxycyclohexane-1-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N(Cc1ccc(Cl)cc1)CC1CCC(C(=O)NO)CC1 |
| InChI | InChI=1S/C22H26Cl2N2O4S/c1-15-20(24)3-2-4-21(15)31(29,30)26(14-17-7-11-19(23)12-8-17)13-16-5-9-18(10-6-16)22(27)25-28/h2-4,7-8,11-12,16,18,28H,5-6,9-10,13-14H2,1H3,(H,25,27) |
| InChIKey | DMZCQIGMEHNMQT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|