C20H18ClFN2O2 — CID 1459958
N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 1459958) has the molecular formula C20H18ClFN2O2 and a molecular weight of 372.83 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1459958 |
| Molecular Formula | C20H18ClFN2O2 |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[(2-chloro-6-methoxyquinolin-3-yl)methyl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | COc1ccc2nc(Cl)c(CN(Cc3ccc(F)cc3)C(C)=O)cc2c1 |
| InChI | InChI=1S/C20H18ClFN2O2/c1-13(25)24(11-14-3-5-17(22)6-4-14)12-16-9-15-10-18(26-2)7-8-19(15)23-20(16)21/h3-10H,11-12H2,1-2H3 |
| InChIKey | DQXLDJWWKDYTSJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|