C23H16Cl2N2O4 — CID 1460043
2-chloro-N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 1460043) has the molecular formula C23H16Cl2N2O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is 2-chloro-N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-chloro-N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1460043 |
| Molecular Formula | C23H16Cl2N2O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 2-chloro-N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccccc1Cl)N(Cc1ccco1)Cc1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C23H16Cl2N2O4/c24-18-6-2-1-5-17(18)23(28)27(12-16-4-3-7-29-16)11-15-8-14-9-20-21(31-13-30-20)10-19(14)26-22(15)25/h1-10H,11-13H2 |
| InChIKey | PJQCSWCYQBOJFL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|