C20H21ClN2O3 — CID 3216916
N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 3216916) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3216916 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCN(Cc1cc2c(C)cc(C)cc2nc1Cl)C(=O)c1ccco1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-13-9-14(2)16-11-15(19(21)22-17(16)10-13)12-23(6-8-25-3)20(24)18-5-4-7-26-18/h4-5,7,9-11H,6,8,12H2,1-3H3 |
| InChIKey | MBNCPSVCEKWGTN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|