C18H23NO6S — CID 42811467
[4-[[furan-2-carbonyl(2-methoxyethyl)amino]methyl]phenyl] propane-2-sulfonate (PubChem CID 42811467) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is [4-[[furan-2-carbonyl(2-methoxyethyl)amino]methyl]phenyl] propane-2-sulfonate.
| Compound Name | [4-[[furan-2-carbonyl(2-methoxyethyl)amino]methyl]phenyl] propane-2-sulfonate |
|---|---|
| PubChem CID | 42811467 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [4-[[furan-2-carbonyl(2-methoxyethyl)amino]methyl]phenyl] propane-2-sulfonate |
| SMILES | COCCN(Cc1ccc(OS(=O)(=O)C(C)C)cc1)C(=O)c1ccco1 |
| InChI | InChI=1S/C18H23NO6S/c1-14(2)26(21,22)25-16-8-6-15(7-9-16)13-19(10-12-23-3)18(20)17-5-4-11-24-17/h4-9,11,14H,10,12-13H2,1-3H3 |
| InChIKey | DLKDAACSNDTVIX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|