C19H25NO5S — CID 42811468
[4-[[butan-2-yl(furan-2-carbonyl)amino]methyl]phenyl] propane-2-sulfonate (PubChem CID 42811468) has the molecular formula C19H25NO5S and a molecular weight of 379.48 g/mol. Its IUPAC name is [4-[[butan-2-yl(furan-2-carbonyl)amino]methyl]phenyl] propane-2-sulfonate.
| Compound Name | [4-[[butan-2-yl(furan-2-carbonyl)amino]methyl]phenyl] propane-2-sulfonate |
|---|---|
| PubChem CID | 42811468 |
| Molecular Formula | C19H25NO5S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [4-[[butan-2-yl(furan-2-carbonyl)amino]methyl]phenyl] propane-2-sulfonate |
| SMILES | CCC(C)N(Cc1ccc(OS(=O)(=O)C(C)C)cc1)C(=O)c1ccco1 |
| InChI | InChI=1S/C19H25NO5S/c1-5-15(4)20(19(21)18-7-6-12-24-18)13-16-8-10-17(11-9-16)25-26(22,23)14(2)3/h6-12,14-15H,5,13H2,1-4H3 |
| InChIKey | AIWKEUKJSQISBN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|