C17H23N3O3 — CID 42815461
N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide (PubChem CID 42815461) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide.
| Compound Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 42815461 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N-[[5-amino-2-(dimethylamino)phenyl]methyl]-N-(2-methoxyethyl)furan-2-carboxamide |
| SMILES | COCCN(Cc1cc(N)ccc1N(C)C)C(=O)c1ccco1 |
| InChI | InChI=1S/C17H23N3O3/c1-19(2)15-7-6-14(18)11-13(15)12-20(8-10-22-3)17(21)16-5-4-9-23-16/h4-7,9,11H,8,10,12,18H2,1-3H3 |
| InChIKey | XYVYPVUVADKAET-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|