C24H27ClN2O4 — CID 3216915
N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-3,4-dimethoxy-N-(2-methoxyethyl)benzamide (PubChem CID 3216915) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-3,4-dimethoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-3,4-dimethoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 3216915 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-3,4-dimethoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1cc2c(C)cc(C)cc2nc1Cl)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H27ClN2O4/c1-15-10-16(2)19-12-18(23(25)26-20(19)11-15)14-27(8-9-29-3)24(28)17-6-7-21(30-4)22(13-17)31-5/h6-7,10-13H,8-9,14H2,1-5H3 |
| InChIKey | FGAWTMFEPZYNIH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|