C27H26N2O3 — CID 3193877
N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 3193877) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 3193877 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-methyl-N-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | COc1ccc(CN(Cc2cc3ccc(C)cc3[nH]c2=O)C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-18-8-11-21-15-22(26(30)28-25(21)14-18)17-29(16-20-9-12-23(32-3)13-10-20)27(31)24-7-5-4-6-19(24)2/h4-15H,16-17H2,1-3H3,(H,28,30) |
| InChIKey | RJZLARCGVSNQEZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |