C30H33N3O4S — CID 1141037
3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-methoxyphenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1141037) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-methoxyphenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-methoxyphenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1141037 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-methoxyphenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3ccc(C)cc3[nH]c2=O)C(=S)NCCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H33N3O4S/c1-20-5-9-23-17-24(29(34)32-26(23)15-20)19-33(18-22-6-10-25(35-2)11-7-22)30(38)31-14-13-21-8-12-27(36-3)28(16-21)37-4/h5-12,15-17H,13-14,18-19H2,1-4H3,(H,31,38)(H,32,34) |
| InChIKey | PIUNMDOHWBTEMP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|