C29H30FN3O3S — CID 1134268
3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1134268) has the molecular formula C29H30FN3O3S and a molecular weight of 519.64 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1134268 |
| Molecular Formula | C29H30FN3O3S |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(4-fluorophenyl)methyl]-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | COc1ccc(CCNC(=S)N(Cc2ccc(F)cc2)Cc2cc3ccc(C)cc3[nH]c2=O)cc1OC |
| InChI | InChI=1S/C29H30FN3O3S/c1-19-4-8-22-16-23(28(34)32-25(22)14-19)18-33(17-21-5-9-24(30)10-6-21)29(37)31-13-12-20-7-11-26(35-2)27(15-20)36-3/h4-11,14-16H,12-13,17-18H2,1-3H3,(H,31,37)(H,32,34) |
| InChIKey | HUWTZMOPPXZMBD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|