C28H30N4O4S — CID 1137543
3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1137543) has the molecular formula C28H30N4O4S and a molecular weight of 518.64 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1137543 |
| Molecular Formula | C28H30N4O4S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc2cc(CN(Cc3cccnc3)C(=S)NCCc3ccc(OC)c(OC)c3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C28H30N4O4S/c1-34-23-8-7-21-14-22(27(33)31-24(21)15-23)18-32(17-20-5-4-11-29-16-20)28(37)30-12-10-19-6-9-25(35-2)26(13-19)36-3/h4-9,11,13-16H,10,12,17-18H2,1-3H3,(H,30,37)(H,31,33) |
| InChIKey | ZURJZPZZAJHXSH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|