C26H26N4O2S — CID 1137542
1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1137542) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1137542 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | COc1ccc2cc(CN(Cc3cccnc3)C(=S)NCCc3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C26H26N4O2S/c1-32-23-10-9-21-14-22(25(31)29-24(21)15-23)18-30(17-20-8-5-12-27-16-20)26(33)28-13-11-19-6-3-2-4-7-19/h2-10,12,14-16H,11,13,17-18H2,1H3,(H,28,33)(H,29,31) |
| InChIKey | CJVYQOUXDTVTLL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|