C24H28FN3O3S — CID 1375390
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1375390) has the molecular formula C24H28FN3O3S and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1375390 |
| Molecular Formula | C24H28FN3O3S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1cc2cc(CN(Cc3ccc(F)cc3)C(=S)NCC(C)C)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C24H28FN3O3S/c1-15(2)12-26-24(32)28(13-16-5-7-19(25)8-6-16)14-18-9-17-10-21(30-3)22(31-4)11-20(17)27-23(18)29/h5-11,15H,12-14H2,1-4H3,(H,26,32)(H,27,29) |
| InChIKey | FWNDCSPVSXCMBX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|