C24H29N3OS — CID 1136840
1-benzyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1136840) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-benzyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-benzyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1136840 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 1-benzyl-1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | Cc1cc2cc(CN(Cc3ccccc3)C(=S)NCC(C)C)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C24H29N3OS/c1-16(2)13-25-24(29)27(14-19-8-6-5-7-9-19)15-21-12-20-10-17(3)18(4)11-22(20)26-23(21)28/h5-12,16H,13-15H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | RTYMRAVRSRDESX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|