C24H22ClN3O2S — CID 1174884
1-benzyl-1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 1174884) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is 1-benzyl-1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1174884 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-benzyl-1-[(7-chloro-6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | Cc1cc2cc(CN(Cc3ccccc3)C(=S)NCc3ccco3)c(=O)[nH]c2cc1Cl |
| InChI | InChI=1S/C24H22ClN3O2S/c1-16-10-18-11-19(23(29)27-22(18)12-21(16)25)15-28(14-17-6-3-2-4-7-17)24(31)26-13-20-8-5-9-30-20/h2-12H,13-15H2,1H3,(H,26,31)(H,27,29) |
| InChIKey | WWADGPUONAVJQF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_N(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|