C23H33N3O3S — CID 1149734
1-cyclohexyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea (PubChem CID 1149734) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 1149734 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-cyclohexyl-1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-methylpropyl)thiourea |
| SMILES | COc1cc2cc(CN(C(=S)NCC(C)C)C3CCCCC3)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C23H33N3O3S/c1-15(2)13-24-23(30)26(18-8-6-5-7-9-18)14-17-10-16-11-20(28-3)21(29-4)12-19(16)25-22(17)27/h10-12,15,18H,5-9,13-14H2,1-4H3,(H,24,30)(H,25,27) |
| InChIKey | ZAIDFXHACADFJX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|