C22H23ClN2O2S — CID 1460017
N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-(thiophen-2-ylmethyl)cyclobutanecarboxamide (PubChem CID 1460017) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-(thiophen-2-ylmethyl)cyclobutanecarboxamide.
| Compound Name | N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-(thiophen-2-ylmethyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 1460017 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(2-chloro-6-ethoxyquinolin-3-yl)methyl]-N-(thiophen-2-ylmethyl)cyclobutanecarboxamide |
| SMILES | CCOc1ccc2nc(Cl)c(CN(Cc3cccs3)C(=O)C3CCC3)cc2c1 |
| InChI | InChI=1S/C22H23ClN2O2S/c1-2-27-18-8-9-20-16(12-18)11-17(21(23)24-20)13-25(14-19-7-4-10-28-19)22(26)15-5-3-6-15/h4,7-12,15H,2-3,5-6,13-14H2,1H3 |
| InChIKey | JXAJRWMRRGRVFO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|