C22H23FN2O3 — CID 42783942
3-tert-butyl-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea (PubChem CID 42783942) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-tert-butyl-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea.
| Compound Name | 3-tert-butyl-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea |
|---|---|
| PubChem CID | 42783942 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-tert-butyl-1-[(4-fluorophenyl)methyl]-1-[(4-oxochromen-3-yl)methyl]urea |
| SMILES | CC(C)(C)NC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O |
| InChI | InChI=1S/C22H23FN2O3/c1-22(2,3)24-21(27)25(12-15-8-10-17(23)11-9-15)13-16-14-28-19-7-5-4-6-18(19)20(16)26/h4-11,14H,12-13H2,1-3H3,(H,24,27) |
| InChIKey | RNXBBQHCUJCKEM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |