C26H27FN2O4 — CID 3687211
N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbutanamide (PubChem CID 3687211) has the molecular formula C26H27FN2O4 and a molecular weight of 450.51 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbutanamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbutanamide |
|---|---|
| PubChem CID | 3687211 |
| Molecular Formula | C26H27FN2O4 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbutanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)CCC |
| InChI | InChI=1S/C26H27FN2O4/c1-3-7-24(30)28(14-4-2)17-25(31)29(15-19-10-12-21(27)13-11-19)16-20-18-33-23-9-6-5-8-22(23)26(20)32/h4-6,8-13,18H,2-3,7,14-17H2,1H3 |
| InChIKey | PCNMKQMRKYFXRZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|