C35H39FN2O4 — CID 3902971
N-butyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-pentylbenzamide (PubChem CID 3902971) has the molecular formula C35H39FN2O4 and a molecular weight of 570.71 g/mol. Its IUPAC name is N-butyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-pentylbenzamide.
| Compound Name | N-butyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-pentylbenzamide |
|---|---|
| PubChem CID | 3902971 |
| Molecular Formula | C35H39FN2O4 |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | N-butyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CCCC)CC(=O)N(Cc2ccc(F)cc2)Cc2coc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C35H39FN2O4/c1-3-5-7-10-26-13-17-28(18-14-26)35(41)37(21-6-4-2)24-33(39)38(22-27-15-19-30(36)20-16-27)23-29-25-42-32-12-9-8-11-31(32)34(29)40/h8-9,11-20,25H,3-7,10,21-24H2,1-2H3 |
| InChIKey | DOSSAMQQDCEYPT-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|