C31H29FN2O4 — CID 5146064
4-ethyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide (PubChem CID 5146064) has the molecular formula C31H29FN2O4 and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-ethyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-ethyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5146064 |
| Molecular Formula | C31H29FN2O4 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 4-ethyl-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C31H29FN2O4/c1-3-17-33(31(37)24-13-9-22(4-2)10-14-24)20-29(35)34(18-23-11-15-26(32)16-12-23)19-25-21-38-28-8-6-5-7-27(28)30(25)36/h3,5-16,21H,1,4,17-20H2,2H3 |
| InChIKey | RLXZLPAKOUVKQI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|