C30H27FN2O5 — CID 4997793
N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-methoxy-N-prop-2-enylbenzamide (PubChem CID 4997793) has the molecular formula C30H27FN2O5 and a molecular weight of 514.55 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-methoxy-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-methoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4997793 |
| Molecular Formula | C30H27FN2O5 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-methoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C30H27FN2O5/c1-3-15-32(30(36)22-7-6-8-25(16-22)37-2)19-28(34)33(17-21-11-13-24(31)14-12-21)18-23-20-38-27-10-5-4-9-26(27)29(23)35/h3-14,16,20H,1,15,17-19H2,2H3 |
| InChIKey | RLIVSFDXLBBLSG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|