C29H24ClFN2O4 — CID 5209899
4-chloro-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide (PubChem CID 5209899) has the molecular formula C29H24ClFN2O4 and a molecular weight of 518.97 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 5209899 |
| Molecular Formula | C29H24ClFN2O4 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 4-chloro-N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H24ClFN2O4/c1-2-15-32(29(36)21-9-11-23(30)12-10-21)18-27(34)33(16-20-7-13-24(31)14-8-20)17-22-19-37-26-6-4-3-5-25(26)28(22)35/h2-14,19H,1,15-18H2 |
| InChIKey | NCIVWWKXEWJUER-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|