C31H27FN2O4 — CID 3298544
N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide (PubChem CID 3298544) has the molecular formula C31H27FN2O4 and a molecular weight of 510.57 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 3298544 |
| Molecular Formula | C31H27FN2O4 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(4-oxochromen-3-yl)methyl]amino]-2-oxoethyl]-3-phenyl-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc(F)cc1)Cc1coc2ccccc2c1=O)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C31H27FN2O4/c1-2-18-33(29(35)17-14-23-8-4-3-5-9-23)21-30(36)34(19-24-12-15-26(32)16-13-24)20-25-22-38-28-11-7-6-10-27(28)31(25)37/h2-17,22H,1,18-21H2 |
| InChIKey | OQRZUHZPNJVQEY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|