C16H12FNO2 — CID 110862760
2-(1-benzofuran-3-yl)-N-(3-fluorophenyl)acetamide (PubChem CID 110862760) has the molecular formula C16H12FNO2 and a molecular weight of 269.28 g/mol. Its IUPAC name is 2-(1-benzofuran-3-yl)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-(1-benzofuran-3-yl)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 110862760 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-(1-benzofuran-3-yl)-N-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1coc2ccccc12)Nc1cccc(F)c1 |
| InChI | InChI=1S/C16H12FNO2/c17-12-4-3-5-13(9-12)18-16(19)8-11-10-20-15-7-2-1-6-14(11)15/h1-7,9-10H,8H2,(H,18,19) |
| InChIKey | KYHHHZBGKXCEDV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |