C16H11ClFNO2 — CID 18860141
N-(3-chlorophenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide (PubChem CID 18860141) has the molecular formula C16H11ClFNO2 and a molecular weight of 303.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18860141 |
| Molecular Formula | C16H11ClFNO2 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(3-chlorophenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
| SMILES | O=C(Cc1coc2ccc(F)cc12)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClFNO2/c17-11-2-1-3-13(7-11)19-16(20)6-10-9-21-15-5-4-12(18)8-14(10)15/h1-5,7-9H,6H2,(H,19,20) |
| InChIKey | DMXRLUBDGIJCHT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |