C25H16FNO4 — CID 18860659
N-(2-benzoyl-1-benzofuran-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide (PubChem CID 18860659) has the molecular formula C25H16FNO4 and a molecular weight of 413.40 g/mol. Its IUPAC name is N-(2-benzoyl-1-benzofuran-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(2-benzoyl-1-benzofuran-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18860659 |
| Molecular Formula | C25H16FNO4 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-(2-benzoyl-1-benzofuran-3-yl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
| SMILES | O=C(Cc1coc2ccc(F)cc12)Nc1c(C(=O)c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C25H16FNO4/c26-17-10-11-20-19(13-17)16(14-30-20)12-22(28)27-23-18-8-4-5-9-21(18)31-25(23)24(29)15-6-2-1-3-7-15/h1-11,13-14H,12H2,(H,27,28) |
| InChIKey | SDZIJRKBZNNUGU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |