C21H14FNO3S — CID 139582398
N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2-thiophen-3-ylacetamide (PubChem CID 139582398) has the molecular formula C21H14FNO3S and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 139582398 |
| Molecular Formula | C21H14FNO3S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | N-[2-(4-fluorobenzoyl)-1-benzofuran-3-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)Nc1c(C(=O)c2ccc(F)cc2)oc2ccccc12 |
| InChI | InChI=1S/C21H14FNO3S/c22-15-7-5-14(6-8-15)20(25)21-19(16-3-1-2-4-17(16)26-21)23-18(24)11-13-9-10-27-12-13/h1-10,12H,11H2,(H,23,24) |
| InChIKey | AAKXROMWORWBNI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |