C18H16FNO2 — CID 18860149
N-(2,5-dimethylphenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide (PubChem CID 18860149) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 18860149 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cc2coc3ccc(F)cc23)c1 |
| InChI | InChI=1S/C18H16FNO2/c1-11-3-4-12(2)16(7-11)20-18(21)8-13-10-22-17-6-5-14(19)9-15(13)17/h3-7,9-10H,8H2,1-2H3,(H,20,21) |
| InChIKey | GISBXXVIMOUVQO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |