C14H16FNO2 — CID 110488706
N-tert-butyl-2-(5-fluoro-1-benzofuran-3-yl)acetamide (PubChem CID 110488706) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is N-tert-butyl-2-(5-fluoro-1-benzofuran-3-yl)acetamide.
| Compound Name | N-tert-butyl-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 110488706 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-tert-butyl-2-(5-fluoro-1-benzofuran-3-yl)acetamide |
| SMILES | CC(C)(C)NC(=O)Cc1coc2ccc(F)cc12 |
| InChI | InChI=1S/C14H16FNO2/c1-14(2,3)16-13(17)6-9-8-18-12-5-4-10(15)7-11(9)12/h4-5,7-8H,6H2,1-3H3,(H,16,17) |
| InChIKey | YEFCYRRVWUQGLF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |