C26H29FN2O — CID 42697504
1-[(4-tert-butylphenyl)methyl]-3-(3-fluorophenyl)-1-(1-phenylethyl)urea (PubChem CID 42697504) has the molecular formula C26H29FN2O and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-(3-fluorophenyl)-1-(1-phenylethyl)urea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-(3-fluorophenyl)-1-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 42697504 |
| Molecular Formula | C26H29FN2O |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-(3-fluorophenyl)-1-(1-phenylethyl)urea |
| SMILES | CC(c1ccccc1)N(Cc1ccc(C(C)(C)C)cc1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C26H29FN2O/c1-19(21-9-6-5-7-10-21)29(25(30)28-24-12-8-11-23(27)17-24)18-20-13-15-22(16-14-20)26(2,3)4/h5-17,19H,18H2,1-4H3,(H,28,30) |
| InChIKey | UIXAAXHBTKYVLX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |