C32H34N2O — CID 3590389
1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-phenylurea (PubChem CID 3590389) has the molecular formula C32H34N2O and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-phenylurea.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-phenylurea |
|---|---|
| PubChem CID | 3590389 |
| Molecular Formula | C32H34N2O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-1-(1,2-diphenylethyl)-3-phenylurea |
| SMILES | CC(C)(C)c1ccc(CN(C(=O)Nc2ccccc2)C(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O/c1-32(2,3)28-21-19-26(20-22-28)24-34(31(35)33-29-17-11-6-12-18-29)30(27-15-9-5-10-16-27)23-25-13-7-4-8-14-25/h4-22,30H,23-24H2,1-3H3,(H,33,35) |
| InChIKey | GYVWKVLDDIZLMY-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |