C15H23Cl2N3S — CID 3559038
3-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-1-ethylthiourea (PubChem CID 3559038) has the molecular formula C15H23Cl2N3S and a molecular weight of 348.34 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-1-ethylthiourea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-1-ethylthiourea |
|---|---|
| PubChem CID | 3559038 |
| Molecular Formula | C15H23Cl2N3S |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[2-(diethylamino)ethyl]-1-ethylthiourea |
| SMILES | CCN(CC)CCN(CC)C(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H23Cl2N3S/c1-4-19(5-2)9-10-20(6-3)15(21)18-12-7-8-13(16)14(17)11-12/h7-8,11H,4-6,9-10H2,1-3H3,(H,18,21) |
| InChIKey | ZZPZLBHHZCCBCL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|