C17H17Cl3N2O2S2 — CID 2818823
1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,4-dichlorophenyl)-1-ethylthiourea (PubChem CID 2818823) has the molecular formula C17H17Cl3N2O2S2 and a molecular weight of 451.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,4-dichlorophenyl)-1-ethylthiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,4-dichlorophenyl)-1-ethylthiourea |
|---|---|
| PubChem CID | 2818823 |
| Molecular Formula | C17H17Cl3N2O2S2 |
| Molecular Weight | 451.83 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,4-dichlorophenyl)-1-ethylthiourea |
| SMILES | CCN(CCS(=O)(=O)c1ccc(Cl)cc1)C(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl3N2O2S2/c1-2-22(17(25)21-13-5-8-15(19)16(20)11-13)9-10-26(23,24)14-6-3-12(18)4-7-14/h3-8,11H,2,9-10H2,1H3,(H,21,25) |
| InChIKey | OUJYNSLLUMWNHA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|