C22H23ClN2O2S3 — CID 134113632
1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 134113632) has the molecular formula C22H23ClN2O2S3 and a molecular weight of 479.09 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 134113632 |
| Molecular Formula | C22H23ClN2O2S3 |
| Molecular Weight | 479.09 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfonylethyl]-3-(3,5-dimethylphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)N(CCS(=O)(=O)c2ccc(Cl)cc2)Cc2cccs2)c1 |
| InChI | InChI=1S/C22H23ClN2O2S3/c1-16-12-17(2)14-19(13-16)24-22(28)25(15-20-4-3-10-29-20)9-11-30(26,27)21-7-5-18(23)6-8-21/h3-8,10,12-14H,9,11,15H2,1-2H3,(H,24,28) |
| InChIKey | ZAZWRDPVKVLHHK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|