C19H34N4S — CID 8615766
1,1-bis[3-(dimethylamino)propyl]-3-(3,5-dimethylphenyl)thiourea (PubChem CID 8615766) has the molecular formula C19H34N4S and a molecular weight of 350.58 g/mol. Its IUPAC name is 1,1-bis[3-(dimethylamino)propyl]-3-(3,5-dimethylphenyl)thiourea.
| Compound Name | 1,1-bis[3-(dimethylamino)propyl]-3-(3,5-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 8615766 |
| Molecular Formula | C19H34N4S |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 1,1-bis[3-(dimethylamino)propyl]-3-(3,5-dimethylphenyl)thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)N(CCCN(C)C)CCCN(C)C)c1 |
| InChI | InChI=1S/C19H34N4S/c1-16-13-17(2)15-18(14-16)20-19(24)23(11-7-9-21(3)4)12-8-10-22(5)6/h13-15H,7-12H2,1-6H3,(H,20,24) |
| InChIKey | ZIGUEDUXCYHNJF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|