C13H21N5OS2 — CID 8659006
1-[2-(dimethylamino)ethyl]-3-[(3-methoxyphenyl)carbamothioylamino]thiourea (PubChem CID 8659006) has the molecular formula C13H21N5OS2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[(3-methoxyphenyl)carbamothioylamino]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[(3-methoxyphenyl)carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 8659006 |
| Molecular Formula | C13H21N5OS2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[(3-methoxyphenyl)carbamothioylamino]thiourea |
| SMILES | COc1cccc(NC(=S)NNC(=S)NCCN(C)C)c1 |
| InChI | InChI=1S/C13H21N5OS2/c1-18(2)8-7-14-12(20)16-17-13(21)15-10-5-4-6-11(9-10)19-3/h4-6,9H,7-8H2,1-3H3,(H2,14,16,20)(H2,15,17,21) |
| InChIKey | DOAYVYJPXIXNFA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 60.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|