C20H36N2O2 — CID 56980865
N-(3,4-dimethoxyphenyl)-N',N'-dipentylethane-1,2-diamine (PubChem CID 56980865) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-N',N'-dipentylethane-1,2-diamine.
| Compound Name | N-(3,4-dimethoxyphenyl)-N',N'-dipentylethane-1,2-diamine |
|---|---|
| PubChem CID | 56980865 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-N',N'-dipentylethane-1,2-diamine |
| SMILES | CCCCCN(CCCCC)CCNc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H36N2O2/c1-5-7-9-14-22(15-10-8-6-2)16-13-21-18-11-12-19(23-3)20(17-18)24-4/h11-12,17,21H,5-10,13-16H2,1-4H3 |
| InChIKey | PACPZCXQUIBWNT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|