C18H30N2S — CID 19653213
1,1-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 19653213) has the molecular formula C18H30N2S and a molecular weight of 306.52 g/mol. Its IUPAC name is 1,1-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1,1-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 19653213 |
| Molecular Formula | C18H30N2S |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1,1-bis(2-methylpropyl)-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)CN(CC(C)C)C(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H30N2S/c1-13(2)11-20(12-14(3)4)18(21)19-17-9-7-16(8-10-17)15(5)6/h7-10,13-15H,11-12H2,1-6H3,(H,19,21) |
| InChIKey | QGGLMCNGOJEIEP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|