C13H25NO2S3 — CID 3347206
octyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (PubChem CID 3347206) has the molecular formula C13H25NO2S3 and a molecular weight of 323.55 g/mol. Its IUPAC name is octyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
| Compound Name | octyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
|---|---|
| PubChem CID | 3347206 |
| Molecular Formula | C13H25NO2S3 |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | octyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| SMILES | CCCCCCCCSC(=S)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO2S3/c1-2-3-4-5-6-7-9-18-13(17)14-12-8-10-19(15,16)11-12/h12H,2-11H2,1H3,(H,14,17) |
| InChIKey | NEQIJRUEMNDUGY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|