C14H17NO4S3 — CID 7174131
methyl 4-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioylsulfanylmethyl]benzoate (PubChem CID 7174131) has the molecular formula C14H17NO4S3 and a molecular weight of 359.49 g/mol. Its IUPAC name is methyl 4-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioylsulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioylsulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7174131 |
| Molecular Formula | C14H17NO4S3 |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | methyl 4-[[(3R)-1,1-dioxothiolan-3-yl]carbamothioylsulfanylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CSC(=S)N[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H17NO4S3/c1-19-13(16)11-4-2-10(3-5-11)8-21-14(20)15-12-6-7-22(17,18)9-12/h2-5,12H,6-9H2,1H3,(H,15,20)/t12-/m1/s1 |
| InChIKey | AISGUKMKDYJASN-GFCCVEGCSA-N |
| XLogP | 1.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|