C20H30BrNO2S3 — CID 3402483
(2-bromo-3,5-ditert-butylphenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (PubChem CID 3402483) has the molecular formula C20H30BrNO2S3 and a molecular weight of 492.57 g/mol. Its IUPAC name is (2-bromo-3,5-ditert-butylphenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
| Compound Name | (2-bromo-3,5-ditert-butylphenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
|---|---|
| PubChem CID | 3402483 |
| Molecular Formula | C20H30BrNO2S3 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | (2-bromo-3,5-ditert-butylphenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| SMILES | CC(C)(C)c1cc(CSC(=S)NC2CCS(=O)(=O)C2)c(Br)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H30BrNO2S3/c1-19(2,3)14-9-13(17(21)16(10-14)20(4,5)6)11-26-18(25)22-15-7-8-27(23,24)12-15/h9-10,15H,7-8,11-12H2,1-6H3,(H,22,25) |
| InChIKey | HLJXDOPRSFCRNH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|